C25H33N3 — CID 146174514
N-(2,4-diethylphenyl)-1-[(1S)-3,3-dimethylcyclohexyl]benzimidazol-2-amine (PubChem CID 146174514) has the molecular formula C25H33N3 and a molecular weight of 375.56 g/mol. Its IUPAC name is N-(2,4-diethylphenyl)-1-[(1S)-3,3-dimethylcyclohexyl]benzimidazol-2-amine.
| Compound Name | N-(2,4-diethylphenyl)-1-[(1S)-3,3-dimethylcyclohexyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 146174514 |
| Molecular Formula | C25H33N3 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | N-(2,4-diethylphenyl)-1-[(1S)-3,3-dimethylcyclohexyl]benzimidazol-2-amine |
| SMILES | CCc1ccc(Nc2nc3ccccc3n2[C@H]2CCCC(C)(C)C2)c(CC)c1 |
| InChI | InChI=1S/C25H33N3/c1-5-18-13-14-21(19(6-2)16-18)26-24-27-22-11-7-8-12-23(22)28(24)20-10-9-15-25(3,4)17-20/h7-8,11-14,16,20H,5-6,9-10,15,17H2,1-4H3,(H,26,27)/t20-/m0/s1 |
| InChIKey | KZTYOMOYGKVIKK-FQEVSTJZSA-N |
| XLogP | 7.05 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |