About 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane
1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane (PubChem CID 146174705) has the molecular formula C11H18F2S2
and a molecular weight of 252.39 g/mol. Its IUPAC name is 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane.
Molecular Properties
| Compound Name | 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane |
| PubChem CID | 146174705 |
| Molecular Formula | C11H18F2S2 |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane |
| SMILES | CS1(/C=C2\CCCCC2(F)F)CCCS1 |
| InChI | InChI=1S/C11H18F2S2/c1-15(8-4-7-14-15)9-10-5-2-3-6-11(10,12)13/h9H,2-8H2,1H3/b10-9+ |
| InChIKey | FWUWZVQGNNCXEV-MDZDMXLPSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane?
The IUPAC name of 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane (CID 146174705) is 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane.
What is the SMILES notation for 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane?
The canonical SMILES for 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane is CS1(/C=C2\CCCCC2(F)F)CCCS1.
What is the InChIKey of 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane?
The InChIKey is FWUWZVQGNNCXEV-MDZDMXLPSA-N. The full InChI is InChI=1S/C11H18F2S2/c1-15(8-4-7-14-15)9-10-5-2-3-6-11(10,12)13/h9H,2-8H2,1H3/b10-9+.
What are the key properties of 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane?
1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane has a molecular weight of 252.39 g/mol, XLogP of 4.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-(2,2-difluorocyclohexylidene)methyl]-1-methyldithiolane is sourced from PubChem (CID 146174705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).