C18H17ClN2 — CID 146174732
2-chloro-4-(3,4,7,8-tetrahydronaphthalen-2-yl)-1,3-diazecine (PubChem CID 146174732) has the molecular formula C18H17ClN2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 2-chloro-4-(3,4,7,8-tetrahydronaphthalen-2-yl)-1,3-diazecine.
| Compound Name | 2-chloro-4-(3,4,7,8-tetrahydronaphthalen-2-yl)-1,3-diazecine |
|---|---|
| PubChem CID | 146174732 |
| Molecular Formula | C18H17ClN2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-chloro-4-(3,4,7,8-tetrahydronaphthalen-2-yl)-1,3-diazecine |
| SMILES | Clc1nccccccc(C2=CC3=C(C=CCC3)CC2)n1 |
| InChI | InChI=1S/C18H17ClN2/c19-18-20-12-6-2-1-3-9-17(21-18)16-11-10-14-7-4-5-8-15(14)13-16/h1-4,6-7,9,12-13H,5,8,10-11H2/b2-1+,3-1-,6-2+,9-3-,12-6-,17-9-,20-12-,20-18-,21-17-,21-18+ |
| InChIKey | AXJOZBSUFAHCNM-FLCPWIAVSA-N |
| XLogP | 5.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |