C14H21N2O3S- — CID 146174754
(2E,3Z,5R)-2-ethylidene-5-(3-oxobutan-2-ylamino)-3-prop-2-enylidenepiperidine-1-sulfinate (PubChem CID 146174754) has the molecular formula C14H21N2O3S- and a molecular weight of 297.40 g/mol. Its IUPAC name is (2E,3Z,5R)-2-ethylidene-5-(3-oxobutan-2-ylamino)-3-prop-2-enylidenepiperidine-1-sulfinate.
| Compound Name | (2E,3Z,5R)-2-ethylidene-5-(3-oxobutan-2-ylamino)-3-prop-2-enylidenepiperidine-1-sulfinate |
|---|---|
| PubChem CID | 146174754 |
| Molecular Formula | C14H21N2O3S- |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (2E,3Z,5R)-2-ethylidene-5-(3-oxobutan-2-ylamino)-3-prop-2-enylidenepiperidine-1-sulfinate |
| SMILES | C=C/C=C1/C[C@@H](NC(C)C(C)=O)CN(S(=O)[O-])/C1=C/C |
| InChI | InChI=1S/C14H22N2O3S/c1-5-7-12-8-13(15-10(3)11(4)17)9-16(20(18)19)14(12)6-2/h5-7,10,13,15H,1,8-9H2,2-4H3,(H,18,19)/p-1/b12-7-,14-6+/t10?,13-/m1/s1 |
| InChIKey | QCRHFDBFZDQIGS-HDJMHOMCSA-M |
| XLogP | 1.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|