C11H16NO3S- — CID 146174774
(2E,3Z,5R)-2-ethylidene-5-(hydroxymethyl)-3-prop-2-enylidenepiperidine-1-sulfinate (PubChem CID 146174774) has the molecular formula C11H16NO3S- and a molecular weight of 242.32 g/mol. Its IUPAC name is (2E,3Z,5R)-2-ethylidene-5-(hydroxymethyl)-3-prop-2-enylidenepiperidine-1-sulfinate.
| Compound Name | (2E,3Z,5R)-2-ethylidene-5-(hydroxymethyl)-3-prop-2-enylidenepiperidine-1-sulfinate |
|---|---|
| PubChem CID | 146174774 |
| Molecular Formula | C11H16NO3S- |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (2E,3Z,5R)-2-ethylidene-5-(hydroxymethyl)-3-prop-2-enylidenepiperidine-1-sulfinate |
| SMILES | C=C/C=C1/C[C@@H](CO)CN(S(=O)[O-])/C1=C/C |
| InChI | InChI=1S/C11H17NO3S/c1-3-5-10-6-9(8-13)7-12(16(14)15)11(10)4-2/h3-5,9,13H,1,6-8H2,2H3,(H,14,15)/p-1/b10-5-,11-4+/t9-/m1/s1 |
| InChIKey | OIYGRDOYWNXDDF-MRWNOYJYSA-M |
| XLogP | 1.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|