C12H19NO3S — CID 146174796
(2E,3Z,6R)-2-ethylidene-5-(hydroxymethyl)-6-methyl-3-prop-2-enylidenepiperidine-1-sulfinic acid (PubChem CID 146174796) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is (2E,3Z,6R)-2-ethylidene-5-(hydroxymethyl)-6-methyl-3-prop-2-enylidenepiperidine-1-sulfinic acid.
| Compound Name | (2E,3Z,6R)-2-ethylidene-5-(hydroxymethyl)-6-methyl-3-prop-2-enylidenepiperidine-1-sulfinic acid |
|---|---|
| PubChem CID | 146174796 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (2E,3Z,6R)-2-ethylidene-5-(hydroxymethyl)-6-methyl-3-prop-2-enylidenepiperidine-1-sulfinic acid |
| SMILES | C=C/C=C1/CC(CO)[C@@H](C)N(S(=O)O)/C1=C/C |
| InChI | InChI=1S/C12H19NO3S/c1-4-6-10-7-11(8-14)9(3)13(17(15)16)12(10)5-2/h4-6,9,11,14H,1,7-8H2,2-3H3,(H,15,16)/b10-6-,12-5+/t9-,11?/m1/s1 |
| InChIKey | MBFOEIBCVLSSPD-RSAZVNQYSA-N |
| XLogP | 1.84 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|