C15H21N2O3S- — CID 146174862
(5Z,6E)-3-(acetamidomethyl)-6-ethylidene-2,2-dimethyl-5-prop-2-enylidenepyridine-1-sulfinate (PubChem CID 146174862) has the molecular formula C15H21N2O3S- and a molecular weight of 309.41 g/mol. Its IUPAC name is (5Z,6E)-3-(acetamidomethyl)-6-ethylidene-2,2-dimethyl-5-prop-2-enylidenepyridine-1-sulfinate.
| Compound Name | (5Z,6E)-3-(acetamidomethyl)-6-ethylidene-2,2-dimethyl-5-prop-2-enylidenepyridine-1-sulfinate |
|---|---|
| PubChem CID | 146174862 |
| Molecular Formula | C15H21N2O3S- |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (5Z,6E)-3-(acetamidomethyl)-6-ethylidene-2,2-dimethyl-5-prop-2-enylidenepyridine-1-sulfinate |
| SMILES | C=C/C=C1/C=C(CNC(C)=O)C(C)(C)N(S(=O)[O-])/C1=C/C |
| InChI | InChI=1S/C15H22N2O3S/c1-6-8-12-9-13(10-16-11(3)18)15(4,5)17(21(19)20)14(12)7-2/h6-9H,1,10H2,2-5H3,(H,16,18)(H,19,20)/p-1/b12-8-,14-7+ |
| InChIKey | DDERAYZKNOGSTM-GLKCHUTISA-M |
| XLogP | 1.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|