C13H19N2O3S- — CID 146174924
(2E,3Z,5S)-5-(acetamidomethyl)-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate (PubChem CID 146174924) has the molecular formula C13H19N2O3S- and a molecular weight of 283.37 g/mol. Its IUPAC name is (2E,3Z,5S)-5-(acetamidomethyl)-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate.
| Compound Name | (2E,3Z,5S)-5-(acetamidomethyl)-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate |
|---|---|
| PubChem CID | 146174924 |
| Molecular Formula | C13H19N2O3S- |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (2E,3Z,5S)-5-(acetamidomethyl)-2-ethylidene-3-prop-2-enylidenepiperidine-1-sulfinate |
| SMILES | C=C/C=C1/C[C@@H](CNC(C)=O)CN(S(=O)[O-])/C1=C/C |
| InChI | InChI=1S/C13H20N2O3S/c1-4-6-12-7-11(8-14-10(3)16)9-15(19(17)18)13(12)5-2/h4-6,11H,1,7-9H2,2-3H3,(H,14,16)(H,17,18)/p-1/b12-6-,13-5+/t11-/m0/s1 |
| InChIKey | IRBUFZMDNUJZNI-HZKWQCMXSA-M |
| XLogP | 1.25 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|