C14H19N2O3S- — CID 146175016
(2E,3Z,5S)-5-(acetamidomethyl)-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate (PubChem CID 146175016) has the molecular formula C14H19N2O3S- and a molecular weight of 295.38 g/mol. Its IUPAC name is (2E,3Z,5S)-5-(acetamidomethyl)-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate.
| Compound Name | (2E,3Z,5S)-5-(acetamidomethyl)-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate |
|---|---|
| PubChem CID | 146175016 |
| Molecular Formula | C14H19N2O3S- |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2E,3Z,5S)-5-(acetamidomethyl)-2,3-bis(prop-2-enylidene)piperidine-1-sulfinate |
| SMILES | C=C/C=C1/C[C@@H](CNC(C)=O)CN(S(=O)[O-])/C1=C/C=C |
| InChI | InChI=1S/C14H20N2O3S/c1-4-6-13-8-12(9-15-11(3)17)10-16(20(18)19)14(13)7-5-2/h4-7,12H,1-2,8-10H2,3H3,(H,15,17)(H,18,19)/p-1/b13-6-,14-7+/t12-/m0/s1 |
| InChIKey | VSXAMUKXPSPARL-QUDVQEBQSA-M |
| XLogP | 1.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|