C14H20N2O3S — CID 146175055
(2R,5Z,6E)-3-(acetamidomethyl)-6-ethylidene-2-methyl-5-prop-2-enylidene-2H-pyridine-1-sulfinic acid (PubChem CID 146175055) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is (2R,5Z,6E)-3-(acetamidomethyl)-6-ethylidene-2-methyl-5-prop-2-enylidene-2H-pyridine-1-sulfinic acid.
| Compound Name | (2R,5Z,6E)-3-(acetamidomethyl)-6-ethylidene-2-methyl-5-prop-2-enylidene-2H-pyridine-1-sulfinic acid |
|---|---|
| PubChem CID | 146175055 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (2R,5Z,6E)-3-(acetamidomethyl)-6-ethylidene-2-methyl-5-prop-2-enylidene-2H-pyridine-1-sulfinic acid |
| SMILES | C=C/C=C1/C=C(CNC(C)=O)[C@@H](C)N(S(=O)O)/C1=C/C |
| InChI | InChI=1S/C14H20N2O3S/c1-5-7-12-8-13(9-15-11(4)17)10(3)16(20(18)19)14(12)6-2/h5-8,10H,1,9H2,2-4H3,(H,15,17)(H,18,19)/b12-7-,14-6+/t10-/m1/s1 |
| InChIKey | WPWTZVOOFPTGHH-WNMPEVOZSA-N |
| XLogP | 1.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|