C14H15F3N2O — CID 146175226
4,5-dimethyl-3-[2-[3-(trifluoromethoxy)phenyl]ethyl]-1H-pyrazole (PubChem CID 146175226) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 4,5-dimethyl-3-[2-[3-(trifluoromethoxy)phenyl]ethyl]-1H-pyrazole.
| Compound Name | 4,5-dimethyl-3-[2-[3-(trifluoromethoxy)phenyl]ethyl]-1H-pyrazole |
|---|---|
| PubChem CID | 146175226 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4,5-dimethyl-3-[2-[3-(trifluoromethoxy)phenyl]ethyl]-1H-pyrazole |
| SMILES | Cc1[nH]nc(CCc2cccc(OC(F)(F)F)c2)c1C |
| InChI | InChI=1S/C14H15F3N2O/c1-9-10(2)18-19-13(9)7-6-11-4-3-5-12(8-11)20-14(15,16)17/h3-5,8H,6-7H2,1-2H3,(H,18,19) |
| InChIKey | PKVJREXOBWTANI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |