About [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine
[4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine (PubChem CID 146175353) has the molecular formula C10H21N3
and a molecular weight of 183.30 g/mol. Its IUPAC name is [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine.
Molecular Properties
| Compound Name | [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine |
| PubChem CID | 146175353 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine |
| SMILES | CN(C)NCC1CC=C(CN)CC1 |
| InChI | InChI=1S/C10H21N3/c1-13(2)12-8-10-5-3-9(7-11)4-6-10/h3,10,12H,4-8,11H2,1-2H3 |
| InChIKey | YRPVDFODDQXZNS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine?
The IUPAC name of [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine (CID 146175353) is [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine.
What is the SMILES notation for [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine?
The canonical SMILES for [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine is CN(C)NCC1CC=C(CN)CC1.
What is the InChIKey of [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine?
The InChIKey is YRPVDFODDQXZNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3/c1-13(2)12-8-10-5-3-9(7-11)4-6-10/h3,10,12H,4-8,11H2,1-2H3.
What are the key properties of [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine?
[4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine has a molecular weight of 183.30 g/mol, XLogP of 0.74, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,2-dimethylhydrazinyl)methyl]cyclohexen-1-yl]methanamine is sourced from PubChem (CID 146175353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).