C17H32O2Si — CID 14617539
ethyl (2E,7Z)-5,5-dimethyl-10-trimethylsilyldeca-2,7-dienoate (PubChem CID 14617539) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is ethyl (2E,7Z)-5,5-dimethyl-10-trimethylsilyldeca-2,7-dienoate.
| Compound Name | ethyl (2E,7Z)-5,5-dimethyl-10-trimethylsilyldeca-2,7-dienoate |
|---|---|
| PubChem CID | 14617539 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | ethyl (2E,7Z)-5,5-dimethyl-10-trimethylsilyldeca-2,7-dienoate |
| SMILES | CCOC(=O)/C=C/CC(C)(C)C/C=C\CC[Si](C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-7-19-16(18)12-11-14-17(2,3)13-9-8-10-15-20(4,5)6/h8-9,11-12H,7,10,13-15H2,1-6H3/b9-8-,12-11+ |
| InChIKey | DMHIALXPNQBHMW-UONSLQGUSA-N |
| XLogP | 5.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|