About 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole
4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole (PubChem CID 146175487) has the molecular formula C14H23F3N2
and a molecular weight of 276.35 g/mol. Its IUPAC name is 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole.
Molecular Properties
| Compound Name | 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole |
| PubChem CID | 146175487 |
| Molecular Formula | C14H23F3N2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole |
| SMILES | CCCCCCc1cnn(CCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H23F3N2/c1-2-3-4-5-8-13-11-18-19(12-13)10-7-6-9-14(15,16)17/h11-12H,2-10H2,1H3 |
| InChIKey | UWWHUFTXEHOTPZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole?
The IUPAC name of 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole (CID 146175487) is 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole.
What is the SMILES notation for 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole?
The canonical SMILES for 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole is CCCCCCc1cnn(CCCCC(F)(F)F)c1.
What is the InChIKey of 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole?
The InChIKey is UWWHUFTXEHOTPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F3N2/c1-2-3-4-5-8-13-11-18-19(12-13)10-7-6-9-14(15,16)17/h11-12H,2-10H2,1H3.
What are the key properties of 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole?
4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole has a molecular weight of 276.35 g/mol, XLogP of 4.74, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexyl-1-(5,5,5-trifluoropentyl)pyrazole is sourced from PubChem (CID 146175487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).