C8H9F5O5 — CID 146175512
[1-(3,3-difluoropropoxy)-2,2,2-trifluoro-1-formyloxyethyl] acetate (PubChem CID 146175512) has the molecular formula C8H9F5O5 and a molecular weight of 280.14 g/mol. Its IUPAC name is [1-(3,3-difluoropropoxy)-2,2,2-trifluoro-1-formyloxyethyl] acetate.
| Compound Name | [1-(3,3-difluoropropoxy)-2,2,2-trifluoro-1-formyloxyethyl] acetate |
|---|---|
| PubChem CID | 146175512 |
| Molecular Formula | C8H9F5O5 |
| Molecular Weight | 280.14 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | [1-(3,3-difluoropropoxy)-2,2,2-trifluoro-1-formyloxyethyl] acetate |
| SMILES | CC(=O)OC(OC=O)(OCCC(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H9F5O5/c1-5(15)18-8(17-4-14,7(11,12)13)16-3-2-6(9)10/h4,6H,2-3H2,1H3 |
| InChIKey | KKMAAQOGKQXQTM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.14 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|