C11H20N2 — CID 146175602
(1R,5R,7S)-7-(aminomethyl)-7-ethyl-3-methylbicyclo[3.2.0]hept-2-en-1-amine (PubChem CID 146175602) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (1R,5R,7S)-7-(aminomethyl)-7-ethyl-3-methylbicyclo[3.2.0]hept-2-en-1-amine.
| Compound Name | (1R,5R,7S)-7-(aminomethyl)-7-ethyl-3-methylbicyclo[3.2.0]hept-2-en-1-amine |
|---|---|
| PubChem CID | 146175602 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (1R,5R,7S)-7-(aminomethyl)-7-ethyl-3-methylbicyclo[3.2.0]hept-2-en-1-amine |
| SMILES | CC[C@@]1(CN)C[C@H]2CC(C)=C[C@]21N |
| InChI | InChI=1S/C11H20N2/c1-3-10(7-12)6-9-4-8(2)5-11(9,10)13/h5,9H,3-4,6-7,12-13H2,1-2H3/t9-,10+,11+/m1/s1 |
| InChIKey | FDRDBQOAEMNPBE-VWYCJHECSA-N |
| XLogP | 1.41 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|