About 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine
4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine (PubChem CID 146176384) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine |
| PubChem CID | 146176384 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine |
| SMILES | CN1CN(C2=CC=NCC2)C1 |
| InChI | InChI=1S/C8H13N3/c1-10-6-11(7-10)8-2-4-9-5-3-8/h2,4H,3,5-7H2,1H3 |
| InChIKey | SSVDMPNYNBEVIZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine?
The IUPAC name of 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine (CID 146176384) is 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine.
What is the SMILES notation for 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine?
The canonical SMILES for 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine is CN1CN(C2=CC=NCC2)C1.
What is the InChIKey of 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine?
The InChIKey is SSVDMPNYNBEVIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-10-6-11(7-10)8-2-4-9-5-3-8/h2,4H,3,5-7H2,1H3.
What are the key properties of 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine?
4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine has a molecular weight of 151.21 g/mol, XLogP of 0.51, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyl-1,3-diazetidin-1-yl)-2,3-dihydropyridine is sourced from PubChem (CID 146176384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).