About 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one
1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one (PubChem CID 146176601) has the molecular formula C16H25NOS
and a molecular weight of 279.45 g/mol. Its IUPAC name is 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one |
| PubChem CID | 146176601 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one |
| SMILES | CC1(C)CC(S(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H25NOS/c1-16(2)11-14(19(3,4)5)15(18)17(16)12-13-9-7-6-8-10-13/h6-10,14H,11-12H2,1-5H3 |
| InChIKey | HEDQKWWUNPWXML-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one?
The IUPAC name of 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one (CID 146176601) is 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one.
What is the SMILES notation for 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one?
The canonical SMILES for 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one is CC1(C)CC(S(C)(C)C)C(=O)N1Cc1ccccc1.
What is the InChIKey of 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one?
The InChIKey is HEDQKWWUNPWXML-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NOS/c1-16(2)11-14(19(3,4)5)15(18)17(16)12-13-9-7-6-8-10-13/h6-10,14H,11-12H2,1-5H3.
What are the key properties of 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one?
1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one has a molecular weight of 279.45 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5,5-dimethyl-3-(trimethyl-λ4-sulfanyl)pyrrolidin-2-one is sourced from PubChem (CID 146176601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).