C6Cu2F12 — CID 14617678
bis(copper(1+));1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane (PubChem CID 14617678) has the molecular formula C6Cu2F12 and a molecular weight of 427.13 g/mol. Its IUPAC name is bis(copper(1+));1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane.
| Compound Name | bis(copper(1+));1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane |
|---|---|
| PubChem CID | 14617678 |
| Molecular Formula | C6Cu2F12 |
| Molecular Weight | 427.13 g/mol |
| Exact Mass | 425.84 |
| IUPAC Name | bis(copper(1+));1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane |
| SMILES | F[C-](F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[C-](F)F.[Cu+].[Cu+] |
| InChI | InChI=1S/C6F12.2Cu/c7-1(8)3(11,12)5(15,16)6(17,18)4(13,14)2(9)10;;/q-2;2*+1 |
| InChIKey | AFZDFJLOSOCWSD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.13 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|