C28H25N7O3 — CID 146177005
4-[8-amino-3-(8-but-2-ynoyl-3-oxa-8-azabicyclo[3.2.1]octan-1-yl)imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide (PubChem CID 146177005) has the molecular formula C28H25N7O3 and a molecular weight of 507.55 g/mol. Its IUPAC name is 4-[8-amino-3-(8-but-2-ynoyl-3-oxa-8-azabicyclo[3.2.1]octan-1-yl)imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[8-amino-3-(8-but-2-ynoyl-3-oxa-8-azabicyclo[3.2.1]octan-1-yl)imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 146177005 |
| Molecular Formula | C28H25N7O3 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 4-[8-amino-3-(8-but-2-ynoyl-3-oxa-8-azabicyclo[3.2.1]octan-1-yl)imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
| SMILES | CC#CC(=O)N1C2CCC1(c1nc(-c3ccc(C(=O)Nc4ccccn4)cc3)c3c(N)nccn13)COC2 |
| InChI | InChI=1S/C28H25N7O3/c1-2-5-22(36)35-20-11-12-28(35,17-38-16-20)27-33-23(24-25(29)31-14-15-34(24)27)18-7-9-19(10-8-18)26(37)32-21-6-3-4-13-30-21/h3-4,6-10,13-15,20H,11-12,16-17H2,1H3,(H2,29,31)(H,30,32,37) |
| InChIKey | OHKCVEKRIXXOCB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|