C30H31N5O2 — CID 146177019
1-[(1R,2S,5S)-2-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one (PubChem CID 146177019) has the molecular formula C30H31N5O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 1-[(1R,2S,5S)-2-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one.
| Compound Name | 1-[(1R,2S,5S)-2-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146177019 |
| Molecular Formula | C30H31N5O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 1-[(1R,2S,5S)-2-[8-amino-1-[4-(1-hydroxy-1-phenylethyl)phenyl]imidazo[1,5-a]pyrazin-3-yl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H]2[C@@H]([C@H]1c1nc(-c3ccc(C(C)(O)c4ccccc4)cc3)c3c(N)nccn13)C2(C)C |
| InChI | InChI=1S/C30H31N5O2/c1-5-22(36)35-17-21-23(29(21,2)3)25(35)28-33-24(26-27(31)32-15-16-34(26)28)18-11-13-20(14-12-18)30(4,37)19-9-7-6-8-10-19/h5-16,21,23,25,37H,1,17H2,2-4H3,(H2,31,32)/t21-,23-,25-,30?/m0/s1 |
| InChIKey | MSXMOPJTOWAVKN-OQSHDVSESA-N |
| XLogP | 4.58 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|