C26H24N8O2 — CID 146177113
4-[8-amino-3-[(4S)-2-prop-2-enoyl-2,5-diazabicyclo[2.2.1]heptan-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide (PubChem CID 146177113) has the molecular formula C26H24N8O2 and a molecular weight of 480.53 g/mol. Its IUPAC name is 4-[8-amino-3-[(4S)-2-prop-2-enoyl-2,5-diazabicyclo[2.2.1]heptan-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[8-amino-3-[(4S)-2-prop-2-enoyl-2,5-diazabicyclo[2.2.1]heptan-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 146177113 |
| Molecular Formula | C26H24N8O2 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 4-[8-amino-3-[(4S)-2-prop-2-enoyl-2,5-diazabicyclo[2.2.1]heptan-3-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
| SMILES | C=CC(=O)N1C2CN[C@@H](C2)C1c1nc(-c2ccc(C(=O)Nc3ccccn3)cc2)c2c(N)nccn12 |
| InChI | InChI=1S/C26H24N8O2/c1-2-20(35)34-17-13-18(30-14-17)22(34)25-32-21(23-24(27)29-11-12-33(23)25)15-6-8-16(9-7-15)26(36)31-19-5-3-4-10-28-19/h2-12,17-18,22,30H,1,13-14H2,(H2,27,29)(H,28,31,36)/t17?,18-,22?/m0/s1 |
| InChIKey | QCZFRIOYASMUKJ-DKTYTTGXSA-N |
| XLogP | 2.43 |
| TPSA | 130.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|