C27H25N5O2 — CID 146177148
1-[(4S)-3-[8-amino-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-2-azabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one (PubChem CID 146177148) has the molecular formula C27H25N5O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 1-[(4S)-3-[8-amino-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-2-azabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(4S)-3-[8-amino-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-2-azabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146177148 |
| Molecular Formula | C27H25N5O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1-[(4S)-3-[8-amino-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-2-azabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C2CC[C@@H](C2)C1c1nc(-c2ccc(Oc3ccccc3)cc2)c2c(N)nccn12 |
| InChI | InChI=1S/C27H25N5O2/c1-2-22(33)32-19-11-8-18(16-19)24(32)27-30-23(25-26(28)29-14-15-31(25)27)17-9-12-21(13-10-17)34-20-6-4-3-5-7-20/h2-7,9-10,12-15,18-19,24H,1,8,11,16H2,(H2,28,29)/t18-,19?,24?/m0/s1 |
| InChIKey | QWPDXQFYBSACJU-BHWOZTKKSA-N |
| XLogP | 5.01 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|