C26H24N6O2 — CID 146177155
1-[(4S)-3-[8-amino-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one (PubChem CID 146177155) has the molecular formula C26H24N6O2 and a molecular weight of 452.52 g/mol. Its IUPAC name is 1-[(4S)-3-[8-amino-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[(4S)-3-[8-amino-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146177155 |
| Molecular Formula | C26H24N6O2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1-[(4S)-3-[8-amino-1-(4-phenoxyphenyl)imidazo[1,5-a]pyrazin-3-yl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C2CN[C@@H](C2)C1c1nc(-c2ccc(Oc3ccccc3)cc2)c2c(N)nccn12 |
| InChI | InChI=1S/C26H24N6O2/c1-2-21(33)32-17-14-20(29-15-17)23(32)26-30-22(24-25(27)28-12-13-31(24)26)16-8-10-19(11-9-16)34-18-6-4-3-5-7-18/h2-13,17,20,23,29H,1,14-15H2,(H2,27,28)/t17?,20-,23?/m0/s1 |
| InChIKey | LFWCTIRKZLSWPZ-GTPZEUEISA-N |
| XLogP | 3.57 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|