About 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine
1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine (PubChem CID 146177169) has the molecular formula C15H28F2N2
and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine |
| PubChem CID | 146177169 |
| Molecular Formula | C15H28F2N2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine |
| SMILES | CC(CN1CCC(C)(C)CC1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C15H28F2N2/c1-13(19-10-6-15(16,17)7-11-19)12-18-8-4-14(2,3)5-9-18/h13H,4-12H2,1-3H3 |
| InChIKey | SMIQMFRAOOQVAH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine?
The IUPAC name of 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine (CID 146177169) is 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine.
What is the SMILES notation for 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine?
The canonical SMILES for 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine is CC(CN1CCC(C)(C)CC1)N1CCC(F)(F)CC1.
What is the InChIKey of 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine?
The InChIKey is SMIQMFRAOOQVAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28F2N2/c1-13(19-10-6-15(16,17)7-11-19)12-18-8-4-14(2,3)5-9-18/h13H,4-12H2,1-3H3.
What are the key properties of 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine?
1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine has a molecular weight of 274.40 g/mol, XLogP of 3.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4,4-difluoropiperidin-1-yl)propyl]-4,4-dimethylpiperidine is sourced from PubChem (CID 146177169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).