C27H25N7O3 — CID 146177201
4-[8-amino-3-(8-prop-2-enoyl-3-oxa-8-azabicyclo[3.2.1]octan-1-yl)imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide (PubChem CID 146177201) has the molecular formula C27H25N7O3 and a molecular weight of 495.54 g/mol. Its IUPAC name is 4-[8-amino-3-(8-prop-2-enoyl-3-oxa-8-azabicyclo[3.2.1]octan-1-yl)imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[8-amino-3-(8-prop-2-enoyl-3-oxa-8-azabicyclo[3.2.1]octan-1-yl)imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 146177201 |
| Molecular Formula | C27H25N7O3 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 4-[8-amino-3-(8-prop-2-enoyl-3-oxa-8-azabicyclo[3.2.1]octan-1-yl)imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
| SMILES | C=CC(=O)N1C2CCC1(c1nc(-c3ccc(C(=O)Nc4ccccn4)cc3)c3c(N)nccn13)COC2 |
| InChI | InChI=1S/C27H25N7O3/c1-2-21(35)34-19-10-11-27(34,16-37-15-19)26-32-22(23-24(28)30-13-14-33(23)26)17-6-8-18(9-7-17)25(36)31-20-5-3-4-12-29-20/h2-9,12-14,19H,1,10-11,15-16H2,(H2,28,30)(H,29,31,36) |
| InChIKey | DAPVVAPHBKMJJH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|