About 4-phenylcarbazol-9-amine
4-phenylcarbazol-9-amine (PubChem CID 146177430) has the molecular formula C18H14N2
and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-phenylcarbazol-9-amine.
Molecular Properties
| Compound Name | 4-phenylcarbazol-9-amine |
| PubChem CID | 146177430 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-phenylcarbazol-9-amine |
| SMILES | Nn1c2ccccc2c2c(-c3ccccc3)cccc21 |
| InChI | InChI=1S/C18H14N2/c19-20-16-11-5-4-9-15(16)18-14(10-6-12-17(18)20)13-7-2-1-3-8-13/h1-12H,19H2 |
| InChIKey | BEKXTRMEEFASMA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenylcarbazol-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylcarbazol-9-amine?
The IUPAC name of 4-phenylcarbazol-9-amine (CID 146177430) is 4-phenylcarbazol-9-amine.
What is the SMILES notation for 4-phenylcarbazol-9-amine?
The canonical SMILES for 4-phenylcarbazol-9-amine is Nn1c2ccccc2c2c(-c3ccccc3)cccc21.
What is the InChIKey of 4-phenylcarbazol-9-amine?
The InChIKey is BEKXTRMEEFASMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2/c19-20-16-11-5-4-9-15(16)18-14(10-6-12-17(18)20)13-7-2-1-3-8-13/h1-12H,19H2.
What are the key properties of 4-phenylcarbazol-9-amine?
4-phenylcarbazol-9-amine has a molecular weight of 258.32 g/mol, XLogP of 4.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylcarbazol-9-amine is sourced from PubChem (CID 146177430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).