C18H22N6O4S — CID 146177464
3-[3-(2-aminopyrimidin-5-yl)-5-morpholin-4-ylphenyl]sulfonylazetidine-1-carboxamide (PubChem CID 146177464) has the molecular formula C18H22N6O4S and a molecular weight of 418.48 g/mol. Its IUPAC name is 3-[3-(2-aminopyrimidin-5-yl)-5-morpholin-4-ylphenyl]sulfonylazetidine-1-carboxamide.
| Compound Name | 3-[3-(2-aminopyrimidin-5-yl)-5-morpholin-4-ylphenyl]sulfonylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 146177464 |
| Molecular Formula | C18H22N6O4S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 3-[3-(2-aminopyrimidin-5-yl)-5-morpholin-4-ylphenyl]sulfonylazetidine-1-carboxamide |
| SMILES | NC(=O)N1CC(S(=O)(=O)c2cc(-c3cnc(N)nc3)cc(N3CCOCC3)c2)C1 |
| InChI | InChI=1S/C18H22N6O4S/c19-17-21-8-13(9-22-17)12-5-14(23-1-3-28-4-2-23)7-15(6-12)29(26,27)16-10-24(11-16)18(20)25/h5-9,16H,1-4,10-11H2,(H2,20,25)(H2,19,21,22) |
| InChIKey | DQCCJKOIQDDDJX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |