About [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate
[4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate (PubChem CID 146177632) has the molecular formula C28H24O7
and a molecular weight of 472.49 g/mol. Its IUPAC name is [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate.
Molecular Properties
| Compound Name | [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate |
| PubChem CID | 146177632 |
| Molecular Formula | C28H24O7 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCOC(=O)Oc1ccc(-c2cc(C)c(-c3ccc(OC(=O)C=C)cc3)cc2C)cc1 |
| InChI | InChI=1S/C28H24O7/c1-5-26(29)32-17-33-28(31)35-23-13-9-21(10-14-23)25-16-18(3)24(15-19(25)4)20-7-11-22(12-8-20)34-27(30)6-2/h5-16H,1-2,17H2,3-4H3 |
| InChIKey | OFIFOZVLYWWVPI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate?
The IUPAC name of [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate (CID 146177632) is [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate.
What is the SMILES notation for [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate?
The canonical SMILES for [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate is C=CC(=O)OCOC(=O)Oc1ccc(-c2cc(C)c(-c3ccc(OC(=O)C=C)cc3)cc2C)cc1.
What is the InChIKey of [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate?
The InChIKey is OFIFOZVLYWWVPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24O7/c1-5-26(29)32-17-33-28(31)35-23-13-9-21(10-14-23)25-16-18(3)24(15-19(25)4)20-7-11-22(12-8-20)34-27(30)6-2/h5-16H,1-2,17H2,3-4H3.
What are the key properties of [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate?
[4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate has a molecular weight of 472.49 g/mol, XLogP of 5.93, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2,5-dimethyl-4-(4-prop-2-enoyloxyphenyl)phenyl]phenoxy]carbonyloxymethyl prop-2-enoate is sourced from PubChem (CID 146177632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).