C33H35F3N8O2 — CID 146177944
3-[(6-cyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-8-ethyl-N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroquinoline-6-carboxamide (PubChem CID 146177944) has the molecular formula C33H35F3N8O2 and a molecular weight of 632.69 g/mol. Its IUPAC name is 3-[(6-cyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-8-ethyl-N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroquinoline-6-carboxamide.
| Compound Name | 3-[(6-cyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-8-ethyl-N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroquinoline-6-carboxamide |
|---|---|
| PubChem CID | 146177944 |
| Molecular Formula | C33H35F3N8O2 |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | 3-[(6-cyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy]-8-ethyl-N-[4-[(4-ethylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydroquinoline-6-carboxamide |
| SMILES | CCC1CC(C(=O)Nc2ccc(CN3CCN(CC)CC3)c(C(F)(F)F)c2)Cc2cc(Oc3ncnc4[nH]c(C#N)cc34)cnc21 |
| InChI | InChI=1S/C33H35F3N8O2/c1-3-20-11-23(12-22-13-26(17-38-29(20)22)46-32-27-14-25(16-37)41-30(27)39-19-40-32)31(45)42-24-6-5-21(28(15-24)33(34,35)36)18-44-9-7-43(4-2)8-10-44/h5-6,13-15,17,19-20,23H,3-4,7-12,18H2,1-2H3,(H,42,45)(H,39,40,41) |
| InChIKey | VHOOWTDGUBXKMB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 123.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |