C30H34N8O4 — CID 146178976
3-[2-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]ethoxy]-N-(oxan-2-yloxy)propanamide (PubChem CID 146178976) has the molecular formula C30H34N8O4 and a molecular weight of 570.65 g/mol. Its IUPAC name is 3-[2-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]ethoxy]-N-(oxan-2-yloxy)propanamide.
| Compound Name | 3-[2-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]ethoxy]-N-(oxan-2-yloxy)propanamide |
|---|---|
| PubChem CID | 146178976 |
| Molecular Formula | C30H34N8O4 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | 3-[2-[4-[[6-(1H-indazol-6-yl)imidazo[1,2-a]pyrazin-8-yl]amino]-N-methylanilino]ethoxy]-N-(oxan-2-yloxy)propanamide |
| SMILES | CN(CCOCCC(=O)NOC1CCCCO1)c1ccc(Nc2nc(-c3ccc4cn[nH]c4c3)cn3ccnc23)cc1 |
| InChI | InChI=1S/C30H34N8O4/c1-37(14-17-40-16-11-27(39)36-42-28-4-2-3-15-41-28)24-9-7-23(8-10-24)33-29-30-31-12-13-38(30)20-26(34-29)21-5-6-22-19-32-35-25(22)18-21/h5-10,12-13,18-20,28H,2-4,11,14-17H2,1H3,(H,32,35)(H,33,34)(H,36,39) |
| InChIKey | NSJMNWKPEXGHCQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 130.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|