About (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione
(3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione (PubChem CID 146179522) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione |
| PubChem CID | 146179522 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione |
| SMILES | C=C/C=C1/C(=O)N(C(C)C)C(=O)/C1=C/C |
| InChI | InChI=1S/C12H15NO2/c1-5-7-10-9(6-2)11(14)13(8(3)4)12(10)15/h5-8H,1H2,2-4H3/b9-6+,10-7+ |
| InChIKey | JMFHDOOKAXXALT-KZZDLZNXSA-N |
| XLogP | 1.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione?
The IUPAC name of (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione (CID 146179522) is (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione.
What is the SMILES notation for (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione?
The canonical SMILES for (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione is C=C/C=C1/C(=O)N(C(C)C)C(=O)/C1=C/C.
What is the InChIKey of (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione?
The InChIKey is JMFHDOOKAXXALT-KZZDLZNXSA-N. The full InChI is InChI=1S/C12H15NO2/c1-5-7-10-9(6-2)11(14)13(8(3)4)12(10)15/h5-8H,1H2,2-4H3/b9-6+,10-7+.
What are the key properties of (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione?
(3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione has a molecular weight of 205.26 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4E)-3-ethylidene-1-propan-2-yl-4-prop-2-enylidenepyrrolidine-2,5-dione is sourced from PubChem (CID 146179522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).