About 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione
3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione (PubChem CID 146179671) has the molecular formula C15H26N2OS2
and a molecular weight of 314.52 g/mol. Its IUPAC name is 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione.
Molecular Properties
| Compound Name | 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione |
| PubChem CID | 146179671 |
| Molecular Formula | C15H26N2OS2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione |
| SMILES | CCN(C)CCOCCNc1c(C(C)(C)C)c(=S)c1=S |
| InChI | InChI=1S/C15H26N2OS2/c1-6-17(5)8-10-18-9-7-16-12-11(15(2,3)4)13(19)14(12)20/h16H,6-10H2,1-5H3 |
| InChIKey | OYJVANHWJUJSPJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione?
The IUPAC name of 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione (CID 146179671) is 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione.
What is the SMILES notation for 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione?
The canonical SMILES for 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione is CCN(C)CCOCCNc1c(C(C)(C)C)c(=S)c1=S.
What is the InChIKey of 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione?
The InChIKey is OYJVANHWJUJSPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2OS2/c1-6-17(5)8-10-18-9-7-16-12-11(15(2,3)4)13(19)14(12)20/h16H,6-10H2,1-5H3.
What are the key properties of 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione?
3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione has a molecular weight of 314.52 g/mol, XLogP of 3.70, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethylamino]cyclobut-3-ene-1,2-dithione is sourced from PubChem (CID 146179671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).