C58H40N4S — CID 146179708
1-[3-dibenzothiophen-2-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methyl-6-phenyl-2-[(1E)-2-phenylbuta-1,3-dienyl]indole (PubChem CID 146179708) has the molecular formula C58H40N4S and a molecular weight of 825.05 g/mol. Its IUPAC name is 1-[3-dibenzothiophen-2-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methyl-6-phenyl-2-[(1E)-2-phenylbuta-1,3-dienyl]indole.
| Compound Name | 1-[3-dibenzothiophen-2-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methyl-6-phenyl-2-[(1E)-2-phenylbuta-1,3-dienyl]indole |
|---|---|
| PubChem CID | 146179708 |
| Molecular Formula | C58H40N4S |
| Molecular Weight | 825.05 g/mol |
| Exact Mass | 824.30 |
| IUPAC Name | 1-[3-dibenzothiophen-2-yl-5-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-methyl-6-phenyl-2-[(1E)-2-phenylbuta-1,3-dienyl]indole |
| SMILES | C=C/C(=C\c1c(C)c2ccc(-c3ccccc3)cc2n1-c1cc(-c2ccc3sc4ccccc4c3c2)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1)c1ccccc1 |
| InChI | InChI=1S/C58H40N4S/c1-3-39(40-18-8-4-9-19-40)36-52-38(2)49-30-28-45(41-20-10-5-11-21-41)37-53(49)62(52)48-33-46(44-29-31-55-51(35-44)50-26-16-17-27-54(50)63-55)32-47(34-48)58-60-56(42-22-12-6-13-23-42)59-57(61-58)43-24-14-7-15-25-43/h3-37H,1H2,2H3/b39-36+ |
| InChIKey | YFWLSRWNJXVXLV-WQBMDMGNSA-N |
| XLogP | 15.55 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.05 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|