C13H14N2O4 — CID 146180545
3-(2,5-dioxo-4-phenylimidazolidin-4-yl)-2-methylpropanoic acid (PubChem CID 146180545) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 3-(2,5-dioxo-4-phenylimidazolidin-4-yl)-2-methylpropanoic acid.
| Compound Name | 3-(2,5-dioxo-4-phenylimidazolidin-4-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 146180545 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-(2,5-dioxo-4-phenylimidazolidin-4-yl)-2-methylpropanoic acid |
| SMILES | CC(CC1(c2ccccc2)NC(=O)NC1=O)C(=O)O |
| InChI | InChI=1S/C13H14N2O4/c1-8(10(16)17)7-13(9-5-3-2-4-6-9)11(18)14-12(19)15-13/h2-6,8H,7H2,1H3,(H,16,17)(H2,14,15,18,19) |
| InChIKey | YAUUYZDXTCHUAO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|