C23H26FN5O3 — CID 146180749
N-[3-fluoro-4-[[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]amino]phenyl]formamide (PubChem CID 146180749) has the molecular formula C23H26FN5O3 and a molecular weight of 439.49 g/mol. Its IUPAC name is N-[3-fluoro-4-[[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]amino]phenyl]formamide.
| Compound Name | N-[3-fluoro-4-[[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]amino]phenyl]formamide |
|---|---|
| PubChem CID | 146180749 |
| Molecular Formula | C23H26FN5O3 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-[3-fluoro-4-[[6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-yl]amino]phenyl]formamide |
| SMILES | COc1cc2c(Nc3ccc(NC=O)cc3F)ncnc2cc1OCC1CCN(C)CC1 |
| InChI | InChI=1S/C23H26FN5O3/c1-29-7-5-15(6-8-29)12-32-22-11-20-17(10-21(22)31-2)23(26-13-25-20)28-19-4-3-16(27-14-30)9-18(19)24/h3-4,9-11,13-15H,5-8,12H2,1-2H3,(H,27,30)(H,25,26,28) |
| InChIKey | GIZUYVMBJMZZLX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|