C9H8F4O6 — CID 146181560
2,2,3,3-tetrafluoro-4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid (PubChem CID 146181560) has the molecular formula C9H8F4O6 and a molecular weight of 288.15 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid.
| Compound Name | 2,2,3,3-tetrafluoro-4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid |
|---|---|
| PubChem CID | 146181560 |
| Molecular Formula | C9H8F4O6 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-oxo-4-(2-prop-2-enoyloxyethoxy)butanoic acid |
| SMILES | C=CC(=O)OCCOC(=O)C(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C9H8F4O6/c1-2-5(14)18-3-4-19-7(17)9(12,13)8(10,11)6(15)16/h2H,1,3-4H2,(H,15,16) |
| InChIKey | CSLIYOLZFORNIX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|