C29H27N2OS+ — CID 14618177
1-ethyl-2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]benzo[e][1,3]benzoxazol-1-ium (PubChem CID 14618177) has the molecular formula C29H27N2OS+ and a molecular weight of 451.62 g/mol. Its IUPAC name is 1-ethyl-2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]benzo[e][1,3]benzoxazol-1-ium.
| Compound Name | 1-ethyl-2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]benzo[e][1,3]benzoxazol-1-ium |
|---|---|
| PubChem CID | 14618177 |
| Molecular Formula | C29H27N2OS+ |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 1-ethyl-2-[(1E,3E,5E,7Z)-7-(3-ethyl-1,3-benzothiazol-2-ylidene)hepta-1,3,5-trienyl]benzo[e][1,3]benzoxazol-1-ium |
| SMILES | CCN1/C(=C/C=C/C=C/C=C/c2oc3ccc4ccccc4c3[n+]2CC)Sc2ccccc21 |
| InChI | InChI=1S/C29H27N2OS/c1-3-30-24-16-12-13-17-26(24)33-28(30)19-9-7-5-6-8-18-27-31(4-2)29-23-15-11-10-14-22(23)20-21-25(29)32-27/h5-21H,3-4H2,1-2H3/q+1 |
| InChIKey | XRMKXBFLIXEQKA-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|