C38H30N4 — CID 146181811
5-(4-benzo[b]carbazol-5-yl-9,9-dimethylindeno[2,1-d]pyrimidin-2-yl)-2-[(Z)-prop-1-enyl]aniline (PubChem CID 146181811) has the molecular formula C38H30N4 and a molecular weight of 542.69 g/mol. Its IUPAC name is 5-(4-benzo[b]carbazol-5-yl-9,9-dimethylindeno[2,1-d]pyrimidin-2-yl)-2-[(Z)-prop-1-enyl]aniline.
| Compound Name | 5-(4-benzo[b]carbazol-5-yl-9,9-dimethylindeno[2,1-d]pyrimidin-2-yl)-2-[(Z)-prop-1-enyl]aniline |
|---|---|
| PubChem CID | 146181811 |
| Molecular Formula | C38H30N4 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 5-(4-benzo[b]carbazol-5-yl-9,9-dimethylindeno[2,1-d]pyrimidin-2-yl)-2-[(Z)-prop-1-enyl]aniline |
| SMILES | C/C=C\c1ccc(-c2nc(-n3c4ccccc4c4cc5ccccc5cc43)c3c(n2)C(C)(C)c2ccccc2-3)cc1N |
| InChI | InChI=1S/C38H30N4/c1-4-11-23-18-19-26(21-31(23)39)36-40-35-34(28-15-7-9-16-30(28)38(35,2)3)37(41-36)42-32-17-10-8-14-27(32)29-20-24-12-5-6-13-25(24)22-33(29)42/h4-22H,39H2,1-3H3/b11-4- |
| InChIKey | MECJYRGSHBUYMJ-WCIBSUBMSA-N |
| XLogP | 9.32 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|