C14H22O — CID 146182266
6-but-3-ynyl-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran (PubChem CID 146182266) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 6-but-3-ynyl-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran.
| Compound Name | 6-but-3-ynyl-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran |
|---|---|
| PubChem CID | 146182266 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 6-but-3-ynyl-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran |
| SMILES | C#CCCC1(C)CCC2C(C)COC2C1 |
| InChI | InChI=1S/C14H22O/c1-4-5-7-14(3)8-6-12-11(2)10-15-13(12)9-14/h1,11-13H,5-10H2,2-3H3 |
| InChIKey | YVOHGJCGUSSEOL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|