About N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine
N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine (PubChem CID 146182511) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine.
Molecular Properties
| Compound Name | N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine |
| PubChem CID | 146182511 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine |
| SMILES | C=C(C)/C(=N\C(C)=C/C)C(C)C |
| InChI | InChI=1S/C11H19N/c1-7-10(6)12-11(8(2)3)9(4)5/h7,9H,2H2,1,3-6H3/b10-7-,12-11+ |
| InChIKey | CNHIUOPQCZAVDD-UPXUIUAPSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine?
The IUPAC name of N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine (CID 146182511) is N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine.
What is the SMILES notation for N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine?
The canonical SMILES for N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine is C=C(C)/C(=N\C(C)=C/C)C(C)C.
What is the InChIKey of N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine?
The InChIKey is CNHIUOPQCZAVDD-UPXUIUAPSA-N. The full InChI is InChI=1S/C11H19N/c1-7-10(6)12-11(8(2)3)9(4)5/h7,9H,2H2,1,3-6H3/b10-7-,12-11+.
What are the key properties of N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine?
N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine has a molecular weight of 165.28 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-but-2-en-2-yl]-2,4-dimethylpent-1-en-3-imine is sourced from PubChem (CID 146182511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).