C19H30N2O3 — CID 146183465
ethyl 4-methyl-2-[5-[2-(3-methylazetidin-1-yl)ethyl]-2-oxo-1-pyridinyl]pentanoate (PubChem CID 146183465) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is ethyl 4-methyl-2-[5-[2-(3-methylazetidin-1-yl)ethyl]-2-oxo-1-pyridinyl]pentanoate.
| Compound Name | ethyl 4-methyl-2-[5-[2-(3-methylazetidin-1-yl)ethyl]-2-oxo-1-pyridinyl]pentanoate |
|---|---|
| PubChem CID | 146183465 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | ethyl 4-methyl-2-[5-[2-(3-methylazetidin-1-yl)ethyl]-2-oxo-1-pyridinyl]pentanoate |
| SMILES | CCOC(=O)C(CC(C)C)n1cc(CCN2CC(C)C2)ccc1=O |
| InChI | InChI=1S/C19H30N2O3/c1-5-24-19(23)17(10-14(2)3)21-13-16(6-7-18(21)22)8-9-20-11-15(4)12-20/h6-7,13-15,17H,5,8-12H2,1-4H3 |
| InChIKey | BUGRTUNDZDKKHJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |