C14H31NO3S — CID 146183949
N-[2-[3-(2,2-dimethylpropoxy)propylsulfonyl]ethyl]-2-methylpropan-1-amine (PubChem CID 146183949) has the molecular formula C14H31NO3S and a molecular weight of 293.47 g/mol. Its IUPAC name is N-[2-[3-(2,2-dimethylpropoxy)propylsulfonyl]ethyl]-2-methylpropan-1-amine.
| Compound Name | N-[2-[3-(2,2-dimethylpropoxy)propylsulfonyl]ethyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 146183949 |
| Molecular Formula | C14H31NO3S |
| Molecular Weight | 293.47 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N-[2-[3-(2,2-dimethylpropoxy)propylsulfonyl]ethyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCCS(=O)(=O)CCCOCC(C)(C)C |
| InChI | InChI=1S/C14H31NO3S/c1-13(2)11-15-7-10-19(16,17)9-6-8-18-12-14(3,4)5/h13,15H,6-12H2,1-5H3 |
| InChIKey | PGIVZCFRPOUTDV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|