C45H30F9N3O6 — CID 146184091
tris[4-[5-(trifluoromethyl)-2-pyridinyl]phenyl] cyclohexane-1,3,5-tricarboxylate (PubChem CID 146184091) has the molecular formula C45H30F9N3O6 and a molecular weight of 879.73 g/mol. Its IUPAC name is tris[4-[5-(trifluoromethyl)-2-pyridinyl]phenyl] cyclohexane-1,3,5-tricarboxylate.
| Compound Name | tris[4-[5-(trifluoromethyl)-2-pyridinyl]phenyl] cyclohexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 146184091 |
| Molecular Formula | C45H30F9N3O6 |
| Molecular Weight | 879.73 g/mol |
| Exact Mass | 879.20 |
| IUPAC Name | tris[4-[5-(trifluoromethyl)-2-pyridinyl]phenyl] cyclohexane-1,3,5-tricarboxylate |
| SMILES | O=C(Oc1ccc(-c2ccc(C(F)(F)F)cn2)cc1)C1CC(C(=O)Oc2ccc(-c3ccc(C(F)(F)F)cn3)cc2)CC(C(=O)Oc2ccc(-c3ccc(C(F)(F)F)cn3)cc2)C1 |
| InChI | InChI=1S/C45H30F9N3O6/c46-43(47,48)31-7-16-37(55-22-31)25-1-10-34(11-2-25)61-40(58)28-19-29(41(59)62-35-12-3-26(4-13-35)38-17-8-32(23-56-38)44(49,50)51)21-30(20-28)42(60)63-36-14-5-27(6-15-36)39-18-9-33(24-57-39)45(52,53)54/h1-18,22-24,28-30H,19-21H2 |
| InChIKey | LHYRJRQTBKDEDZ-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.73 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|