About 6-propan-2-ylpentazine
6-propan-2-ylpentazine (PubChem CID 146184208) has the molecular formula C4H7N5
and a molecular weight of 125.13 g/mol. Its IUPAC name is 6-propan-2-ylpentazine.
Molecular Properties
| Compound Name | 6-propan-2-ylpentazine |
| PubChem CID | 146184208 |
| Molecular Formula | C4H7N5 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.07 |
| IUPAC Name | 6-propan-2-ylpentazine |
| SMILES | CC(C)c1nnnnn1 |
| InChI | InChI=1S/C4H7N5/c1-3(2)4-5-7-9-8-6-4/h3H,1-2H3 |
| InChIKey | XTZCFVFJVGAKGD-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-propan-2-ylpentazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-ylpentazine?
The IUPAC name of 6-propan-2-ylpentazine (CID 146184208) is 6-propan-2-ylpentazine.
What is the SMILES notation for 6-propan-2-ylpentazine?
The canonical SMILES for 6-propan-2-ylpentazine is CC(C)c1nnnnn1.
What is the InChIKey of 6-propan-2-ylpentazine?
The InChIKey is XTZCFVFJVGAKGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N5/c1-3(2)4-5-7-9-8-6-4/h3H,1-2H3.
What are the key properties of 6-propan-2-ylpentazine?
6-propan-2-ylpentazine has a molecular weight of 125.13 g/mol, XLogP of -0.22, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-ylpentazine is sourced from PubChem (CID 146184208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).