About (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine
(5-imino-3,3-dimethylcyclopenten-1-yl)methanamine (PubChem CID 146184303) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine.
Molecular Properties
| Compound Name | (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine |
| PubChem CID | 146184303 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine |
| SMILES | [H]/N=C1\CC(C)(C)C=C1CN |
| InChI | InChI=1S/C8H14N2/c1-8(2)3-6(5-9)7(10)4-8/h3,10H,4-5,9H2,1-2H3/b10-7+ |
| InChIKey | ABDWMZSPKFTXEJ-JXMROGBWSA-N |
| XLogP | 1.32 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine?
The IUPAC name of (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine (CID 146184303) is (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine.
What is the SMILES notation for (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine?
The canonical SMILES for (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine is [H]/N=C1\CC(C)(C)C=C1CN.
What is the InChIKey of (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine?
The InChIKey is ABDWMZSPKFTXEJ-JXMROGBWSA-N. The full InChI is InChI=1S/C8H14N2/c1-8(2)3-6(5-9)7(10)4-8/h3,10H,4-5,9H2,1-2H3/b10-7+.
What are the key properties of (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine?
(5-imino-3,3-dimethylcyclopenten-1-yl)methanamine has a molecular weight of 138.21 g/mol, XLogP of 1.32, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-imino-3,3-dimethylcyclopenten-1-yl)methanamine is sourced from PubChem (CID 146184303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).