C16H35NO — CID 146184541
3-(3,6,8-trimethyldecoxy)propan-1-amine (PubChem CID 146184541) has the molecular formula C16H35NO and a molecular weight of 257.46 g/mol. Its IUPAC name is 3-(3,6,8-trimethyldecoxy)propan-1-amine.
| Compound Name | 3-(3,6,8-trimethyldecoxy)propan-1-amine |
|---|---|
| PubChem CID | 146184541 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | 3-(3,6,8-trimethyldecoxy)propan-1-amine |
| SMILES | CCC(C)CC(C)CCC(C)CCOCCCN |
| InChI | InChI=1S/C16H35NO/c1-5-14(2)13-16(4)8-7-15(3)9-12-18-11-6-10-17/h14-16H,5-13,17H2,1-4H3 |
| InChIKey | IEAVMNGPKCURES-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|