C20H26N4 — CID 146184680
(2Z)-2-[1-(3,5-dimethyl-1,2,4-triazol-4-yl)ethylidene]-3,4-dimethyl-1-(4-methylphenyl)pent-3-en-1-imine (PubChem CID 146184680) has the molecular formula C20H26N4 and a molecular weight of 322.46 g/mol. Its IUPAC name is (2Z)-2-[1-(3,5-dimethyl-1,2,4-triazol-4-yl)ethylidene]-3,4-dimethyl-1-(4-methylphenyl)pent-3-en-1-imine.
| Compound Name | (2Z)-2-[1-(3,5-dimethyl-1,2,4-triazol-4-yl)ethylidene]-3,4-dimethyl-1-(4-methylphenyl)pent-3-en-1-imine |
|---|---|
| PubChem CID | 146184680 |
| Molecular Formula | C20H26N4 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | (2Z)-2-[1-(3,5-dimethyl-1,2,4-triazol-4-yl)ethylidene]-3,4-dimethyl-1-(4-methylphenyl)pent-3-en-1-imine |
| SMILES | [H]/N=C(C(/C(C)=C(C)C)=C(/C)n1c(C)nnc1C)\c1ccc(C)cc1 |
| InChI | InChI=1S/C20H26N4/c1-12(2)14(4)19(15(5)24-16(6)22-23-17(24)7)20(21)18-10-8-13(3)9-11-18/h8-11,21H,1-7H3/b19-15-,21-20+ |
| InChIKey | CRTXUUXYOADGNA-FCYXFUCKSA-N |
| XLogP | 4.86 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|