C33H52N5O4PS — CID 146184756
2-[3-[[2-(1,3-azaphospholidine-2-carbonylamino)-3-methylpentanoyl]amino]-4-methylpentyl]-N-[(6Z,8Z)-6-ethenyl-2-methyl-1-oxodeca-6,8-dien-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 146184756) has the molecular formula C33H52N5O4PS and a molecular weight of 645.85 g/mol. Its IUPAC name is 2-[3-[[2-(1,3-azaphospholidine-2-carbonylamino)-3-methylpentanoyl]amino]-4-methylpentyl]-N-[(6Z,8Z)-6-ethenyl-2-methyl-1-oxodeca-6,8-dien-4-yl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[3-[[2-(1,3-azaphospholidine-2-carbonylamino)-3-methylpentanoyl]amino]-4-methylpentyl]-N-[(6Z,8Z)-6-ethenyl-2-methyl-1-oxodeca-6,8-dien-4-yl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 146184756 |
| Molecular Formula | C33H52N5O4PS |
| Molecular Weight | 645.85 g/mol |
| Exact Mass | 645.35 |
| IUPAC Name | 2-[3-[[2-(1,3-azaphospholidine-2-carbonylamino)-3-methylpentanoyl]amino]-4-methylpentyl]-N-[(6Z,8Z)-6-ethenyl-2-methyl-1-oxodeca-6,8-dien-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | C=C/C(=C\C=C/C)CC(CC(C)C=O)NC(=O)c1csc(CCC(NC(=O)C(NC(=O)C2NCCP2)C(C)CC)C(C)C)n1 |
| InChI | InChI=1S/C33H52N5O4PS/c1-8-11-12-24(10-3)18-25(17-22(6)19-39)35-30(40)27-20-44-28(36-27)14-13-26(21(4)5)37-31(41)29(23(7)9-2)38-32(42)33-34-15-16-43-33/h8,10-12,19-23,25-26,29,33-34,43H,3,9,13-18H2,1-2,4-7H3,(H,35,40)(H,37,41)(H,38,42)/b11-8-,24-12+ |
| InChIKey | BYGZFAPWBOQJEM-WDGZXENRSA-N |
| XLogP | 4.76 |
| TPSA | 129.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.85 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|