About 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene
1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene (PubChem CID 146184894) has the molecular formula C14H18F2
and a molecular weight of 224.29 g/mol. Its IUPAC name is 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene.
Molecular Properties
| Compound Name | 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene |
| PubChem CID | 146184894 |
| Molecular Formula | C14H18F2 |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene |
| SMILES | CC(C)(C)CC1CC1c1ccc(F)cc1F |
| InChI | InChI=1S/C14H18F2/c1-14(2,3)8-9-6-12(9)11-5-4-10(15)7-13(11)16/h4-5,7,9,12H,6,8H2,1-3H3 |
| InChIKey | LJJWUEUJXUWDKX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene?
The IUPAC name of 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene (CID 146184894) is 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene.
What is the SMILES notation for 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene?
The canonical SMILES for 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene is CC(C)(C)CC1CC1c1ccc(F)cc1F.
What is the InChIKey of 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene?
The InChIKey is LJJWUEUJXUWDKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2/c1-14(2,3)8-9-6-12(9)11-5-4-10(15)7-13(11)16/h4-5,7,9,12H,6,8H2,1-3H3.
What are the key properties of 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene?
1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene has a molecular weight of 224.29 g/mol, XLogP of 4.50, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,2-dimethylpropyl)cyclopropyl]-2,4-difluorobenzene is sourced from PubChem (CID 146184894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).